C22H27N3O5S2 — CID 55477911
3-(4-methoxyphenyl)-N-[1-oxo-1-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]propan-2-yl]prop-2-enamide (PubChem CID 55477911) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[1-oxo-1-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]propan-2-yl]prop-2-enamide.
| Compound Name | 3-(4-methoxyphenyl)-N-[1-oxo-1-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55477911 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[1-oxo-1-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]propan-2-yl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NC(C)C(=O)N2CCC(NS(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O5S2/c1-16(23-20(26)10-7-17-5-8-19(30-2)9-6-17)22(27)25-13-11-18(12-14-25)24-32(28,29)21-4-3-15-31-21/h3-10,15-16,18,24H,11-14H2,1-2H3,(H,23,26) |
| InChIKey | CDAUKGLEMQHELB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|