C24H33N5O4 — CID 55810056
1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 55810056) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55810056 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)N1CCCC(C(=O)Nc3ccc(C)cn3)C1)C2=O |
| InChI | InChI=1S/C24H33N5O4/c1-3-17-8-10-24(11-9-17)22(32)29(23(33)27-24)15-20(30)28-12-4-5-18(14-28)21(31)26-19-7-6-16(2)13-25-19/h6-7,13,17-18H,3-5,8-12,14-15H2,1-2H3,(H,27,33)(H,25,26,31) |
| InChIKey | BYPPARFIVHFNRK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|