C20H21FN6O3S — CID 55812028
3-[4-(diethylsulfamoyl)phenyl]-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 55812028) has the molecular formula C20H21FN6O3S and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55812028 |
| Molecular Formula | C20H21FN6O3S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C=CC(=O)Nc2cc(-n3cnnn3)ccc2F)cc1 |
| InChI | InChI=1S/C20H21FN6O3S/c1-3-26(4-2)31(29,30)17-9-5-15(6-10-17)7-12-20(28)23-19-13-16(8-11-18(19)21)27-14-22-24-25-27/h5-14H,3-4H2,1-2H3,(H,23,28) |
| InChIKey | AEQYTJDZXKTYOE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|