C16H10Cl2FN5O — CID 55814140
3-(2,5-dichlorophenyl)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 55814140) has the molecular formula C16H10Cl2FN5O and a molecular weight of 378.19 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | 3-(2,5-dichlorophenyl)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55814140 |
| Molecular Formula | C16H10Cl2FN5O |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cc(Cl)ccc1Cl)Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C16H10Cl2FN5O/c17-11-2-4-13(18)10(7-11)1-6-16(25)21-15-8-12(3-5-14(15)19)24-9-20-22-23-24/h1-9H,(H,21,25) |
| InChIKey | GBECONCGOXTECN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|