C21H13FN6OS — CID 55812092
2-(2-cyanophenyl)sulfanyl-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 55812092) has the molecular formula C21H13FN6OS and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-(2-cyanophenyl)sulfanyl-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 2-(2-cyanophenyl)sulfanyl-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55812092 |
| Molecular Formula | C21H13FN6OS |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-(2-cyanophenyl)sulfanyl-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | N#Cc1ccccc1Sc1ccccc1C(=O)Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C21H13FN6OS/c22-17-10-9-15(28-13-24-26-27-28)11-18(17)25-21(29)16-6-2-4-8-20(16)30-19-7-3-1-5-14(19)12-23/h1-11,13H,(H,25,29) |
| InChIKey | RXUCBLFTJOPKJZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |