C10H12F2O — CID 558186
10,10-difluorotricyclo[5.2.1.02,6]dec-8-en-3-ol (PubChem CID 558186) has the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. Its IUPAC name is 10,10-difluorotricyclo[5.2.1.02,6]dec-8-en-3-ol.
| Compound Name | 10,10-difluorotricyclo[5.2.1.02,6]dec-8-en-3-ol |
|---|---|
| PubChem CID | 558186 |
| Molecular Formula | C10H12F2O |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 10,10-difluorotricyclo[5.2.1.02,6]dec-8-en-3-ol |
| SMILES | OC1CCC2C1C1C=CC2C1(F)F |
| InChI | InChI=1S/C10H12F2O/c11-10(12)6-2-3-7(10)9-5(6)1-4-8(9)13/h2-3,5-9,13H,1,4H2 |
| InChIKey | FUXLEDUEBDBSNW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|