C20H20N2O2S2 — CID 55827003
N-[3-(1,3-dithiolan-2-yl)phenyl]-6-ethoxy-1H-indole-2-carboxamide (PubChem CID 55827003) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-6-ethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-6-ethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55827003 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-6-ethoxy-1H-indole-2-carboxamide |
| SMILES | CCOc1ccc2cc(C(=O)Nc3cccc(C4SCCS4)c3)[nH]c2c1 |
| InChI | InChI=1S/C20H20N2O2S2/c1-2-24-16-7-6-13-11-18(22-17(13)12-16)19(23)21-15-5-3-4-14(10-15)20-25-8-9-26-20/h3-7,10-12,20,22H,2,8-9H2,1H3,(H,21,23) |
| InChIKey | AUPMZGZGNJGUCG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |