C19H22ClN3O5S — CID 55832622
methyl 6-[2-(3-chlorophenyl)ethylamino]-5-morpholin-4-ylsulfonylpyridine-3-carboxylate (PubChem CID 55832622) has the molecular formula C19H22ClN3O5S and a molecular weight of 439.92 g/mol. Its IUPAC name is methyl 6-[2-(3-chlorophenyl)ethylamino]-5-morpholin-4-ylsulfonylpyridine-3-carboxylate.
| Compound Name | methyl 6-[2-(3-chlorophenyl)ethylamino]-5-morpholin-4-ylsulfonylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 55832622 |
| Molecular Formula | C19H22ClN3O5S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | methyl 6-[2-(3-chlorophenyl)ethylamino]-5-morpholin-4-ylsulfonylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(NCCc2cccc(Cl)c2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H22ClN3O5S/c1-27-19(24)15-12-17(29(25,26)23-7-9-28-10-8-23)18(22-13-15)21-6-5-14-3-2-4-16(20)11-14/h2-4,11-13H,5-10H2,1H3,(H,21,22) |
| InChIKey | LSNUFMIAPQXNOX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |