C23H30N4O6S — CID 55829991
methyl 6-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-5-morpholin-4-ylsulfonylpyridine-3-carboxylate (PubChem CID 55829991) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is methyl 6-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-5-morpholin-4-ylsulfonylpyridine-3-carboxylate.
| Compound Name | methyl 6-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-5-morpholin-4-ylsulfonylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 55829991 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | methyl 6-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-5-morpholin-4-ylsulfonylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(N2CCCN(c3ccc(OC)cc3)CC2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H30N4O6S/c1-31-20-6-4-19(5-7-20)25-8-3-9-26(11-10-25)22-21(16-18(17-24-22)23(28)32-2)34(29,30)27-12-14-33-15-13-27/h4-7,16-17H,3,8-15H2,1-2H3 |
| InChIKey | YNTHMSPCGWUPPP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|