C19H21N3O6 — CID 55834584
methyl 5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-methyl-4-propyl-1H-pyrrole-3-carboxylate (PubChem CID 55834584) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is methyl 5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-methyl-4-propyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-methyl-4-propyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55834584 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | methyl 5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-methyl-4-propyl-1H-pyrrole-3-carboxylate |
| SMILES | CCCc1c(C(=O)NNC(=O)c2ccc3c(c2)OCO3)[nH]c(C)c1C(=O)OC |
| InChI | InChI=1S/C19H21N3O6/c1-4-5-12-15(19(25)26-3)10(2)20-16(12)18(24)22-21-17(23)11-6-7-13-14(8-11)28-9-27-13/h6-8,20H,4-5,9H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | BLHCJKDLPBTLHP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|