C19H22N2O6 — CID 55785707
methyl 5-[2-(1,3-benzodioxol-5-yloxy)ethylcarbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate (PubChem CID 55785707) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is methyl 5-[2-(1,3-benzodioxol-5-yloxy)ethylcarbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[2-(1,3-benzodioxol-5-yloxy)ethylcarbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55785707 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | methyl 5-[2-(1,3-benzodioxol-5-yloxy)ethylcarbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCc1[nH]c(C(=O)NCCOc2ccc3c(c2)OCO3)c(C)c1C(=O)OC |
| InChI | InChI=1S/C19H22N2O6/c1-4-13-16(19(23)24-3)11(2)17(21-13)18(22)20-7-8-25-12-5-6-14-15(9-12)27-10-26-14/h5-6,9,21H,4,7-8,10H2,1-3H3,(H,20,22) |
| InChIKey | OKOLPEBSPXZVIQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|