C13H16FN7O3S — CID 55835988
2-[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 55835988) has the molecular formula C13H16FN7O3S and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 55835988 |
| Molecular Formula | C13H16FN7O3S |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | CN(C)CCn1nnnc1SCC(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16FN7O3S/c1-19(2)5-6-20-13(16-17-18-20)25-8-12(22)15-9-3-4-10(14)11(7-9)21(23)24/h3-4,7H,5-6,8H2,1-2H3,(H,15,22) |
| InChIKey | MHHYWXPMJRVPOB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|