C25H33N3O5 — CID 55838917
2-[4-(2,6-dimethoxyphenoxy)piperidin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55838917) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[4-(2,6-dimethoxyphenoxy)piperidin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[4-(2,6-dimethoxyphenoxy)piperidin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55838917 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-[4-(2,6-dimethoxyphenoxy)piperidin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1cccc(OC)c1OC1CCN(CC(=O)Nc2ccc(N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C25H33N3O5/c1-30-22-4-3-5-23(31-2)25(22)33-21-10-12-27(13-11-21)18-24(29)26-19-6-8-20(9-7-19)28-14-16-32-17-15-28/h3-9,21H,10-18H2,1-2H3,(H,26,29) |
| InChIKey | WNMUFJHIEUBBLZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|