C22H24ClFN4O5 — CID 55842315
N'-[2-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]acetyl]-3,4-dimethoxybenzohydrazide (PubChem CID 55842315) has the molecular formula C22H24ClFN4O5 and a molecular weight of 478.91 g/mol. Its IUPAC name is N'-[2-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]acetyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[2-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]acetyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 55842315 |
| Molecular Formula | C22H24ClFN4O5 |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N'-[2-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]acetyl]-3,4-dimethoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CN2CCN(C(=O)c3cc(Cl)ccc3F)CC2)cc1OC |
| InChI | InChI=1S/C22H24ClFN4O5/c1-32-18-6-3-14(11-19(18)33-2)21(30)26-25-20(29)13-27-7-9-28(10-8-27)22(31)16-12-15(23)4-5-17(16)24/h3-6,11-12H,7-10,13H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | KQTNNDIVFOLMQA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|