C20H33N3O4 — CID 55859946
1-[(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)methyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide (PubChem CID 55859946) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-[(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)methyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)methyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55859946 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 1-[(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)methyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(CN2C(=O)CC3(CCCC3)C2=O)CC1 |
| InChI | InChI=1S/C20H33N3O4/c1-2-27-13-5-10-21-18(25)16-6-11-22(12-7-16)15-23-17(24)14-20(19(23)26)8-3-4-9-20/h16H,2-15H2,1H3,(H,21,25) |
| InChIKey | JYXCQOWKDDZWPA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|