C24H24N4O4 — CID 55877912
3-[[[4-(cyclopropylcarbamoylamino)benzoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 55877912) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-[[[4-(cyclopropylcarbamoylamino)benzoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[[4-(cyclopropylcarbamoylamino)benzoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55877912 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-[[[4-(cyclopropylcarbamoylamino)benzoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(C(=O)NCc2cccc(C(=O)NCc3ccco3)c2)cc1)NC1CC1 |
| InChI | InChI=1S/C24H24N4O4/c29-22(17-6-8-19(9-7-17)27-24(31)28-20-10-11-20)25-14-16-3-1-4-18(13-16)23(30)26-15-21-5-2-12-32-21/h1-9,12-13,20H,10-11,14-15H2,(H,25,29)(H,26,30)(H2,27,28,31) |
| InChIKey | ZNWWULANZWDXMF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |