C24H32N4O4 — CID 55924941
3-[[4-(cyclohexylcarbamoylamino)butanoylamino]methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 55924941) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-[[4-(cyclohexylcarbamoylamino)butanoylamino]methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[4-(cyclohexylcarbamoylamino)butanoylamino]methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55924941 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3-[[4-(cyclohexylcarbamoylamino)butanoylamino]methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NCc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C24H32N4O4/c29-22(12-5-13-25-24(31)28-20-9-2-1-3-10-20)26-16-18-7-4-8-19(15-18)23(30)27-17-21-11-6-14-32-21/h4,6-8,11,14-15,20H,1-3,5,9-10,12-13,16-17H2,(H,26,29)(H,27,30)(H2,25,28,31) |
| InChIKey | JQRODRMHRNWFFJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|