C22H21NO5S — CID 55879229
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(2-methoxyethoxy)phenyl]thiophene-2-carboxamide (PubChem CID 55879229) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(2-methoxyethoxy)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(2-methoxyethoxy)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55879229 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(2-methoxyethoxy)phenyl]thiophene-2-carboxamide |
| SMILES | COCCOc1cccc(NC(=O)c2ccc(-c3ccc4c(c3)OCCO4)s2)c1 |
| InChI | InChI=1S/C22H21NO5S/c1-25-9-10-26-17-4-2-3-16(14-17)23-22(24)21-8-7-20(29-21)15-5-6-18-19(13-15)28-12-11-27-18/h2-8,13-14H,9-12H2,1H3,(H,23,24) |
| InChIKey | RHELWPSONITGER-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|