C25H26ClN3O2 — CID 55879934
6-chloro-N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-2-methylquinoline-3-carboxamide (PubChem CID 55879934) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 6-chloro-N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-2-methylquinoline-3-carboxamide.
| Compound Name | 6-chloro-N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 55879934 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 6-chloro-N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-2-methylquinoline-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCCCC2)ccc1NC(=O)c1cc2cc(Cl)ccc2nc1C |
| InChI | InChI=1S/C25H26ClN3O2/c1-15-12-17(24(30)28-20-6-4-3-5-7-20)8-10-22(15)29-25(31)21-14-18-13-19(26)9-11-23(18)27-16(21)2/h8-14,20H,3-7H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | FKDPAECBTSUULX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |