C22H27NO7 — CID 55881567
methyl 2-[3-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethylcarbamoyl]phenoxy]acetate (PubChem CID 55881567) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is methyl 2-[3-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethylcarbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethylcarbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 55881567 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | methyl 2-[3-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethylcarbamoyl]phenoxy]acetate |
| SMILES | COCCOc1ccc(C(C)NC(=O)c2cccc(OCC(=O)OC)c2)cc1OC |
| InChI | InChI=1S/C22H27NO7/c1-15(16-8-9-19(20(13-16)27-3)29-11-10-26-2)23-22(25)17-6-5-7-18(12-17)30-14-21(24)28-4/h5-9,12-13,15H,10-11,14H2,1-4H3,(H,23,25) |
| InChIKey | OVQUAXACPAFHOA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|