C22H23N3O5S — CID 55881893
3-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1-oxo-4H-isochromene-3-carboxamide (PubChem CID 55881893) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 3-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1-oxo-4H-isochromene-3-carboxamide.
| Compound Name | 3-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1-oxo-4H-isochromene-3-carboxamide |
|---|---|
| PubChem CID | 55881893 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 3-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1-oxo-4H-isochromene-3-carboxamide |
| SMILES | CN1CCC/C1=N\S(=O)(=O)c1cccc(NC(=O)C2(C)Cc3ccccc3C(=O)O2)c1 |
| InChI | InChI=1S/C22H23N3O5S/c1-22(14-15-7-3-4-10-18(15)20(26)30-22)21(27)23-16-8-5-9-17(13-16)31(28,29)24-19-11-6-12-25(19)2/h3-5,7-10,13H,6,11-12,14H2,1-2H3,(H,23,27)/b24-19+ |
| InChIKey | ZUXHBBNMVXXKMR-LYBHJNIJSA-N |
| XLogP | 2.61 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|