C20H17F2NO3 — CID 55889101
N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-phenoxypropanamide (PubChem CID 55889101) has the molecular formula C20H17F2NO3 and a molecular weight of 357.36 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-phenoxypropanamide.
| Compound Name | N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-phenoxypropanamide |
|---|---|
| PubChem CID | 55889101 |
| Molecular Formula | C20H17F2NO3 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-phenoxypropanamide |
| SMILES | CC(Oc1ccccc1)C(=O)N(Cc1ccco1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H17F2NO3/c1-14(26-16-6-3-2-4-7-16)20(24)23(13-17-8-5-11-25-17)19-10-9-15(21)12-18(19)22/h2-12,14H,13H2,1H3 |
| InChIKey | LZWFGOXVSQKGMF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |