C18H11ClF2N2O4 — CID 75416181
5-chloro-N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-nitrobenzamide (PubChem CID 75416181) has the molecular formula C18H11ClF2N2O4 and a molecular weight of 392.75 g/mol. Its IUPAC name is 5-chloro-N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-nitrobenzamide.
| Compound Name | 5-chloro-N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 75416181 |
| Molecular Formula | C18H11ClF2N2O4 |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 5-chloro-N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-nitrobenzamide |
| SMILES | O=C(c1cc(Cl)ccc1[N+](=O)[O-])N(Cc1ccco1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H11ClF2N2O4/c19-11-3-5-16(23(25)26)14(8-11)18(24)22(10-13-2-1-7-27-13)17-6-4-12(20)9-15(17)21/h1-9H,10H2 |
| InChIKey | IBRIWAZEHBHQIC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|