C22H16F2N2O4 — CID 55889353
N-(2,4-difluorophenyl)-3-(2,5-dioxopyrrolidin-1-yl)-N-(furan-2-ylmethyl)benzamide (PubChem CID 55889353) has the molecular formula C22H16F2N2O4 and a molecular weight of 410.38 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-(2,5-dioxopyrrolidin-1-yl)-N-(furan-2-ylmethyl)benzamide.
| Compound Name | N-(2,4-difluorophenyl)-3-(2,5-dioxopyrrolidin-1-yl)-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55889353 |
| Molecular Formula | C22H16F2N2O4 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-(2,5-dioxopyrrolidin-1-yl)-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(N2C(=O)CCC2=O)c1)N(Cc1ccco1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H16F2N2O4/c23-15-6-7-19(18(24)12-15)25(13-17-5-2-10-30-17)22(29)14-3-1-4-16(11-14)26-20(27)8-9-21(26)28/h1-7,10-12H,8-9,13H2 |
| InChIKey | MQYJMAKQVBAKTL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|