C21H19F2NO2 — CID 55889992
N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-3-phenylbutanamide (PubChem CID 55889992) has the molecular formula C21H19F2NO2 and a molecular weight of 355.38 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-3-phenylbutanamide.
| Compound Name | N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-3-phenylbutanamide |
|---|---|
| PubChem CID | 55889992 |
| Molecular Formula | C21H19F2NO2 |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)-3-phenylbutanamide |
| SMILES | CC(CC(=O)N(Cc1ccco1)c1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C21H19F2NO2/c1-15(16-6-3-2-4-7-16)12-21(25)24(14-18-8-5-11-26-18)20-10-9-17(22)13-19(20)23/h2-11,13,15H,12,14H2,1H3 |
| InChIKey | QLDIKFQOTTYPFQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |