C14H12N6O5S — CID 55895321
2-methoxy-4-nitro-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzenesulfonamide (PubChem CID 55895321) has the molecular formula C14H12N6O5S and a molecular weight of 376.35 g/mol. Its IUPAC name is 2-methoxy-4-nitro-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 2-methoxy-4-nitro-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55895321 |
| Molecular Formula | C14H12N6O5S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-methoxy-4-nitro-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzenesulfonamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1S(=O)(=O)Nc1ccc(-n2cncn2)nc1 |
| InChI | InChI=1S/C14H12N6O5S/c1-25-12-6-11(20(21)22)3-4-13(12)26(23,24)18-10-2-5-14(16-7-10)19-9-15-8-17-19/h2-9,18H,1H3 |
| InChIKey | KLERQCQGAQMIGL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|