C19H18BrClFNO3S — CID 55898827
N-[(2-bromo-5-fluorophenyl)methyl]-1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxamide (PubChem CID 55898827) has the molecular formula C19H18BrClFNO3S and a molecular weight of 474.78 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxamide.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55898827 |
| Molecular Formula | C19H18BrClFNO3S |
| Molecular Weight | 474.78 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxamide |
| SMILES | O=C(NCc1cc(F)ccc1Br)C1(S(=O)(=O)c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C19H18BrClFNO3S/c20-17-8-5-15(22)11-13(17)12-23-18(24)19(9-1-2-10-19)27(25,26)16-6-3-14(21)4-7-16/h3-8,11H,1-2,9-10,12H2,(H,23,24) |
| InChIKey | WGMNIZLXNHPGDP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |