C16H20BrFN2O2 — CID 55981867
1-acetamido-N-[(2-bromo-5-fluorophenyl)methyl]cyclohexane-1-carboxamide (PubChem CID 55981867) has the molecular formula C16H20BrFN2O2 and a molecular weight of 371.25 g/mol. Its IUPAC name is 1-acetamido-N-[(2-bromo-5-fluorophenyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 1-acetamido-N-[(2-bromo-5-fluorophenyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 55981867 |
| Molecular Formula | C16H20BrFN2O2 |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-acetamido-N-[(2-bromo-5-fluorophenyl)methyl]cyclohexane-1-carboxamide |
| SMILES | CC(=O)NC1(C(=O)NCc2cc(F)ccc2Br)CCCCC1 |
| InChI | InChI=1S/C16H20BrFN2O2/c1-11(21)20-16(7-3-2-4-8-16)15(22)19-10-12-9-13(18)5-6-14(12)17/h5-6,9H,2-4,7-8,10H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | JUSBFPXPZQNQFY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |