C15H12Br2O6S — CID 55907203
methyl 2-(2,4-dibromophenyl)sulfonyloxy-4-methoxybenzoate (PubChem CID 55907203) has the molecular formula C15H12Br2O6S and a molecular weight of 480.13 g/mol. Its IUPAC name is methyl 2-(2,4-dibromophenyl)sulfonyloxy-4-methoxybenzoate.
| Compound Name | methyl 2-(2,4-dibromophenyl)sulfonyloxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 55907203 |
| Molecular Formula | C15H12Br2O6S |
| Molecular Weight | 480.13 g/mol |
| Exact Mass | 477.87 |
| IUPAC Name | methyl 2-(2,4-dibromophenyl)sulfonyloxy-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)cc1OS(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H12Br2O6S/c1-21-10-4-5-11(15(18)22-2)13(8-10)23-24(19,20)14-6-3-9(16)7-12(14)17/h3-8H,1-2H3 |
| InChIKey | HCIRAZWBGRDOOV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.13 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|