C21H25FN6O — CID 55909998
N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide (PubChem CID 55909998) has the molecular formula C21H25FN6O and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55909998 |
| Molecular Formula | C21H25FN6O |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)Cc1cc(C(=O)Nc2ccc(F)c(-c3nnc4n3CCCCC4)c2)n[nH]1 |
| InChI | InChI=1S/C21H25FN6O/c1-13(2)10-15-12-18(25-24-15)21(29)23-14-7-8-17(22)16(11-14)20-27-26-19-6-4-3-5-9-28(19)20/h7-8,11-13H,3-6,9-10H2,1-2H3,(H,23,29)(H,24,25) |
| InChIKey | CQFKFLLUERJKTH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |