C17H21F3N6O — CID 55910993
1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea (PubChem CID 55910993) has the molecular formula C17H21F3N6O and a molecular weight of 382.39 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea.
| Compound Name | 1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea |
|---|---|
| PubChem CID | 55910993 |
| Molecular Formula | C17H21F3N6O |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea |
| SMILES | CN(C)c1ncccc1CNC(=O)NCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C17H21F3N6O/c1-26(2)15-12(5-3-8-23-15)11-25-16(27)24-10-9-22-14-13(17(18,19)20)6-4-7-21-14/h3-8H,9-11H2,1-2H3,(H,21,22)(H2,24,25,27) |
| InChIKey | ILDKZZYQMSFUPO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|