C17H18BrF3N4O — CID 55909192
1-[1-(3-bromophenyl)ethyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea (PubChem CID 55909192) has the molecular formula C17H18BrF3N4O and a molecular weight of 431.26 g/mol. Its IUPAC name is 1-[1-(3-bromophenyl)ethyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea.
| Compound Name | 1-[1-(3-bromophenyl)ethyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea |
|---|---|
| PubChem CID | 55909192 |
| Molecular Formula | C17H18BrF3N4O |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1-[1-(3-bromophenyl)ethyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]urea |
| SMILES | CC(NC(=O)NCCNc1ncccc1C(F)(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H18BrF3N4O/c1-11(12-4-2-5-13(18)10-12)25-16(26)24-9-8-23-15-14(17(19,20)21)6-3-7-22-15/h2-7,10-11H,8-9H2,1H3,(H,22,23)(H2,24,25,26) |
| InChIKey | IGLFCGILSYDYDE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|