C19H19BrClN3O3S — CID 55914989
3-bromo-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1H-indole-2-carboxamide (PubChem CID 55914989) has the molecular formula C19H19BrClN3O3S and a molecular weight of 484.80 g/mol. Its IUPAC name is 3-bromo-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1H-indole-2-carboxamide.
| Compound Name | 3-bromo-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55914989 |
| Molecular Formula | C19H19BrClN3O3S |
| Molecular Weight | 484.80 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | 3-bromo-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1H-indole-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2[nH]c3ccccc3c2Br)ccc1Cl |
| InChI | InChI=1S/C19H19BrClN3O3S/c1-3-24(4-2)28(26,27)16-11-12(9-10-14(16)21)22-19(25)18-17(20)13-7-5-6-8-15(13)23-18/h5-11,23H,3-4H2,1-2H3,(H,22,25) |
| InChIKey | IJRZQMWEWJLMPU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.80 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |