C20H24N6O5S — CID 55919558
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-(2-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 55919558) has the molecular formula C20H24N6O5S and a molecular weight of 460.52 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-(2-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-(2-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 55919558 |
| Molecular Formula | C20H24N6O5S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-(2-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)Nc1ccccc1S(=O)(=O)N1CCCCC1)c(=O)n2C |
| InChI | InChI=1S/C20H24N6O5S/c1-23-13-21-18-17(23)19(28)26(20(29)24(18)2)12-16(27)22-14-8-4-5-9-15(14)32(30,31)25-10-6-3-7-11-25/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3,(H,22,27) |
| InChIKey | RRCJDQACRFBRAZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 128.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |