C19H21F2N3O3S — CID 55921499
1-[4-(difluoromethylsulfonyl)phenyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 55921499) has the molecular formula C19H21F2N3O3S and a molecular weight of 409.46 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)phenyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-[4-(difluoromethylsulfonyl)phenyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55921499 |
| Molecular Formula | C19H21F2N3O3S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)phenyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)C2CCN(c3ccc(S(=O)(=O)C(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C19H21F2N3O3S/c1-13-6-9-22-17(12-13)23-18(25)14-7-10-24(11-8-14)15-2-4-16(5-3-15)28(26,27)19(20)21/h2-6,9,12,14,19H,7-8,10-11H2,1H3,(H,22,23,25) |
| InChIKey | CGZYBDPJKHOFPT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |