C21H27BrN2O5S — CID 55922068
methyl 2-bromo-5-[[4-[2-(diethylamino)ethoxy]phenyl]methylsulfamoyl]benzoate (PubChem CID 55922068) has the molecular formula C21H27BrN2O5S and a molecular weight of 499.43 g/mol. Its IUPAC name is methyl 2-bromo-5-[[4-[2-(diethylamino)ethoxy]phenyl]methylsulfamoyl]benzoate.
| Compound Name | methyl 2-bromo-5-[[4-[2-(diethylamino)ethoxy]phenyl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 55922068 |
| Molecular Formula | C21H27BrN2O5S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | methyl 2-bromo-5-[[4-[2-(diethylamino)ethoxy]phenyl]methylsulfamoyl]benzoate |
| SMILES | CCN(CC)CCOc1ccc(CNS(=O)(=O)c2ccc(Br)c(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C21H27BrN2O5S/c1-4-24(5-2)12-13-29-17-8-6-16(7-9-17)15-23-30(26,27)18-10-11-20(22)19(14-18)21(25)28-3/h6-11,14,23H,4-5,12-13,15H2,1-3H3 |
| InChIKey | GVOTZINWTIZLBZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |