C24H28ClN3O6 — CID 55923277
1-[4-[4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoyl]piperazin-1-yl]-4-methylpentan-1-one (PubChem CID 55923277) has the molecular formula C24H28ClN3O6 and a molecular weight of 489.96 g/mol. Its IUPAC name is 1-[4-[4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoyl]piperazin-1-yl]-4-methylpentan-1-one.
| Compound Name | 1-[4-[4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoyl]piperazin-1-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 55923277 |
| Molecular Formula | C24H28ClN3O6 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 1-[4-[4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoyl]piperazin-1-yl]-4-methylpentan-1-one |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)CCC(C)C)CC2)ccc1Oc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H28ClN3O6/c1-16(2)4-9-23(29)26-10-12-27(13-11-26)24(30)17-5-7-21(22(14-17)33-3)34-20-8-6-18(25)15-19(20)28(31)32/h5-8,14-16H,4,9-13H2,1-3H3 |
| InChIKey | CZWHPUDFQDGWKY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|