C20H29N3OS — CID 55928798
4-[[4-(2-butylsulfanylpropanoyl)-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 55928798) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is 4-[[4-(2-butylsulfanylpropanoyl)-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(2-butylsulfanylpropanoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 55928798 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 4-[[4-(2-butylsulfanylpropanoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | CCCCSC(C)C(=O)N1CCCN(Cc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C20H29N3OS/c1-3-4-14-25-17(2)20(24)23-11-5-10-22(12-13-23)16-19-8-6-18(15-21)7-9-19/h6-9,17H,3-5,10-14,16H2,1-2H3 |
| InChIKey | WZGHWKNSRZDJHQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|