C21H20F3N3O4S2 — CID 55942253
[(4R)-3-benzoyl-1,3-thiazolidin-4-yl]-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55942253) has the molecular formula C21H20F3N3O4S2 and a molecular weight of 499.54 g/mol. Its IUPAC name is [(4R)-3-benzoyl-1,3-thiazolidin-4-yl]-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [(4R)-3-benzoyl-1,3-thiazolidin-4-yl]-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55942253 |
| Molecular Formula | C21H20F3N3O4S2 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | [(4R)-3-benzoyl-1,3-thiazolidin-4-yl]-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C([C@@H]1CSCN1C(=O)c1ccccc1)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H20F3N3O4S2/c22-15-6-7-17(19(24)18(15)23)33(30,31)26-10-8-25(9-11-26)21(29)16-12-32-13-27(16)20(28)14-4-2-1-3-5-14/h1-7,16H,8-13H2/t16-/m0/s1 |
| InChIKey | GXVJMJDXIAYIAD-INIZCTEOSA-N |
| XLogP | 2.15 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|