C20H18F2N4O5 — CID 55943376
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate (PubChem CID 55943376) has the molecular formula C20H18F2N4O5 and a molecular weight of 432.38 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate.
| Compound Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55943376 |
| Molecular Formula | C20H18F2N4O5 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate |
| SMILES | CC(OC(=O)[C@H](C)NC(=O)c1cccc([N+](=O)[O-])c1)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C20H18F2N4O5/c1-11(23-18(27)13-6-5-7-14(10-13)26(29)30)19(28)31-12(2)17-24-15-8-3-4-9-16(15)25(17)20(21)22/h3-12,20H,1-2H3,(H,23,27)/t11-,12?/m0/s1 |
| InChIKey | MBPXEERNTANTOU-PXYINDEMSA-N |
| XLogP | 3.76 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|