C21H21ClN2O3 — CID 55947389
1-[2-(4-chlorophenyl)morpholin-4-yl]-2-(5-methoxyindol-1-yl)ethanone (PubChem CID 55947389) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)morpholin-4-yl]-2-(5-methoxyindol-1-yl)ethanone.
| Compound Name | 1-[2-(4-chlorophenyl)morpholin-4-yl]-2-(5-methoxyindol-1-yl)ethanone |
|---|---|
| PubChem CID | 55947389 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-[2-(4-chlorophenyl)morpholin-4-yl]-2-(5-methoxyindol-1-yl)ethanone |
| SMILES | COc1ccc2c(ccn2CC(=O)N2CCOC(c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C21H21ClN2O3/c1-26-18-6-7-19-16(12-18)8-9-23(19)14-21(25)24-10-11-27-20(13-24)15-2-4-17(22)5-3-15/h2-9,12,20H,10-11,13-14H2,1H3 |
| InChIKey | PJYCWSXTLHWSQB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |