C21H17N3O3 — CID 55950302
N-(3-ethynylphenyl)-2-[[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]acetamide (PubChem CID 55950302) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-[[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]acetamide.
| Compound Name | N-(3-ethynylphenyl)-2-[[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 55950302 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(3-ethynylphenyl)-2-[[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]acetamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)CN2C(=C)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H17N3O3/c1-3-15-7-6-8-16(11-15)23-19(25)12-22-20(26)13-24-14(2)17-9-4-5-10-18(17)21(24)27/h1,4-11H,2,12-13H2,(H,22,26)(H,23,25) |
| InChIKey | BQRYNCMDBPNPHK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|