C18H23N3O4S — CID 55954561
N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide (PubChem CID 55954561) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55954561 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NCCOc2ccc3c(c2)CCC3)n(C)c1 |
| InChI | InChI=1S/C18H23N3O4S/c1-19-26(23,24)16-11-17(21(2)12-16)18(22)20-8-9-25-15-7-6-13-4-3-5-14(13)10-15/h6-7,10-12,19H,3-5,8-9H2,1-2H3,(H,20,22) |
| InChIKey | WRZUALBTGNHQNP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|