C23H24ClN3O3S — CID 55959590
2-chloro-N-[1-[[2-(3-ethynylanilino)-2-oxoethyl]-methylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 55959590) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is 2-chloro-N-[1-[[2-(3-ethynylanilino)-2-oxoethyl]-methylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[[2-(3-ethynylanilino)-2-oxoethyl]-methylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55959590 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-chloro-N-[1-[[2-(3-ethynylanilino)-2-oxoethyl]-methylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)C(CCSC)NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H24ClN3O3S/c1-4-16-8-7-9-17(14-16)25-21(28)15-27(2)23(30)20(12-13-31-3)26-22(29)18-10-5-6-11-19(18)24/h1,5-11,14,20H,12-13,15H2,2-3H3,(H,25,28)(H,26,29) |
| InChIKey | PKNVKTJWGYSKLR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|