C24H32N6O3S — CID 55961268
(Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]prop-2-enamide (PubChem CID 55961268) has the molecular formula C24H32N6O3S and a molecular weight of 484.63 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55961268 |
| Molecular Formula | C24H32N6O3S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(/C#N)C(=O)NCCS(=O)(=O)N2CCN(c3ccccn3)CC2)c1C |
| InChI | InChI=1S/C24H32N6O3S/c1-4-10-30-19(2)16-21(20(30)3)17-22(18-25)24(31)27-9-15-34(32,33)29-13-11-28(12-14-29)23-7-5-6-8-26-23/h5-8,16-17H,4,9-15H2,1-3H3,(H,27,31)/b22-17- |
| InChIKey | MFVYZMRQMXRVNJ-XLNRJJMWSA-N |
| XLogP | 2.09 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|