C19H20Cl2N4O3 — CID 55963098
N-[2-[[2-(butanoylamino)-3,5-dichlorobenzoyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 55963098) has the molecular formula C19H20Cl2N4O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is N-[2-[[2-(butanoylamino)-3,5-dichlorobenzoyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[2-(butanoylamino)-3,5-dichlorobenzoyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55963098 |
| Molecular Formula | C19H20Cl2N4O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[2-[[2-(butanoylamino)-3,5-dichlorobenzoyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | CCCC(=O)Nc1c(Cl)cc(Cl)cc1C(=O)NCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C19H20Cl2N4O3/c1-2-4-16(26)25-17-14(9-13(20)10-15(17)21)19(28)24-8-7-23-18(27)12-5-3-6-22-11-12/h3,5-6,9-11H,2,4,7-8H2,1H3,(H,23,27)(H,24,28)(H,25,26) |
| InChIKey | ZBWSFIKLLPUWFE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|