C23H23Cl2FN2O2 — CID 55963687
1-[3-(2,3-dichlorophenyl)prop-2-enoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 55963687) has the molecular formula C23H23Cl2FN2O2 and a molecular weight of 449.35 g/mol. Its IUPAC name is 1-[3-(2,3-dichlorophenyl)prop-2-enoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-(2,3-dichlorophenyl)prop-2-enoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55963687 |
| Molecular Formula | C23H23Cl2FN2O2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 1-[3-(2,3-dichlorophenyl)prop-2-enoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCN(C(=O)C=Cc3cccc(Cl)c3Cl)CC2)cc1F |
| InChI | InChI=1S/C23H23Cl2FN2O2/c1-15-5-6-16(13-20(15)26)14-27-23(30)18-9-11-28(12-10-18)21(29)8-7-17-3-2-4-19(24)22(17)25/h2-8,13,18H,9-12,14H2,1H3,(H,27,30) |
| InChIKey | WRJWRAGLHOROJL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|