C27H31N3O3S — CID 55966910
N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide (PubChem CID 55966910) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide.
| Compound Name | N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 55966910 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)c1cccc(NC(=O)CCCc2cccs2)c1 |
| InChI | InChI=1S/C27H31N3O3S/c1-29(20-21-10-12-24(13-11-21)30-14-16-33-17-15-30)27(32)22-5-2-6-23(19-22)28-26(31)9-3-7-25-8-4-18-34-25/h2,4-6,8,10-13,18-19H,3,7,9,14-17,20H2,1H3,(H,28,31) |
| InChIKey | QKYHZPBTZXNRRZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|