C27H28F2N4O2 — CID 55976702
3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpropanamide (PubChem CID 55976702) has the molecular formula C27H28F2N4O2 and a molecular weight of 478.54 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpropanamide.
| Compound Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 55976702 |
| Molecular Formula | C27H28F2N4O2 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpropanamide |
| SMILES | CN(CCCCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)CCc1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C27H28F2N4O2/c1-33(27(34)14-13-26-30-18-25(35-26)22-11-4-5-12-23(22)29)15-6-2-3-10-21-17-24(32-31-21)19-8-7-9-20(28)16-19/h4-5,7-9,11-12,16-18H,2-3,6,10,13-15H2,1H3,(H,31,32) |
| InChIKey | DOLQGPQTRITCIU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|