C17H15BrN6O5 — CID 55995992
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 55995992) has the molecular formula C17H15BrN6O5 and a molecular weight of 463.25 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 55995992 |
| Molecular Formula | C17H15BrN6O5 |
| Molecular Weight | 463.25 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC(C)c1c(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)cnc2ncnn12 |
| InChI | InChI=1S/C17H15BrN6O5/c1-9(2)15-11(6-19-17-20-8-21-23(15)17)16(26)29-7-14(25)22-13-4-3-10(24(27)28)5-12(13)18/h3-6,8-9H,7H2,1-2H3,(H,22,25) |
| InChIKey | VGKMMYJKBDBFBE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|